Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A236 | Purity: >98% |
 | |
| Chemical structure of MP470 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Amuvatinib |
|---|---|
| CAS No. | 850879-09-3 |
| Purity | >98% |
| Formula | C23H21N5O3S |
| Mol Weight | 447.51 |
| CoA | CoA of MP470 |
| Smiles: | S=C(NCC1=CC=C2OCOC2=C1)N1CCN(CC1)C1=C2OC3=CC=CC=C3C2=NC=N1 |
|---|
KEYWORDS: buy MP470 | MP470 supplier | purchase | cost | manufacturer | order | distributor | buy 850879-09-3 | 850879-09-3 supplier