Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1988 | Purity: >98% |
 | |
| Chemical structure of Monastrol |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | (+/-)-Monastrol |
|---|---|
| CAS No. | 329689-23-8 |
| Purity | >98% |
| Formula | C14H16N2O3S |
| Mol Weight | 292.353 |
| CoA | CoA of Monastrol |
| Smiles: | CCOC(=O)C1=C(C)NC(=S)NC1C1=CC(O)=CC=C1 |
|---|
KEYWORDS: buy Monastrol | Monastrol supplier | purchase | cost | manufacturer | order | distributor | buy 329689-23-8 | 329689-23-8 supplier