Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A024 | Purity: >98% |
 | |
| Chemical structure of MLN8237 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Alisertib |
|---|---|
| CAS No. | 1028486-01-2 |
| Purity | >98% |
| Formula | C27H20ClFN4O4 |
| Mol Weight | 518.924 |
| CoA | CoA of MLN8237 |
| Smiles: | COC1=CC(NC2=NC=C3CN=C(C4=CC(Cl)=CC=C4C3=N2)C2=C(OC)C=CC=C2F)=CC=C1C(O)=O |
|---|
KEYWORDS: buy MLN8237 | MLN8237 supplier | purchase | cost | manufacturer | order | distributor | buy 1028486-01-2 | 1028486-01-2 supplier