Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1112 | Purity: >98% |
 | |
| Chemical structure of MLN1117 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | INK1117 |
|---|---|
| CAS No. | 1268454-23-4 |
| Purity | >98% |
| Formula | C19H17N5O3 |
| Mol Weight | 363.37 |
| CoA | CoA of MLN1117 |
| Smiles: | NC1=NC2=CC(=CC=C2O1)C1=CN2C(=CN=C2C=C1)C(=O)N1CCOCC1 |
|---|
KEYWORDS: buy MLN1117 | MLN1117 supplier | purchase | cost | manufacturer | order | distributor | buy 1268454-23-4 | 1268454-23-4 supplier