Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4087 | Purity: >98% |
 | |
| Chemical structure of ML417 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1386162-69-1 |
|---|---|
| Purity | >98% |
| Formula | C22H25N3O3 |
| Mol Weight | 379.4522 |
| CoA | CoA of ML417 |
| Smiles: | O=C(C(N1)=CC2=C1C=CC=C2)N3CCN(CCOC4=CC=C(OC)C=C4)CC3 |
|---|
KEYWORDS: buy ML417 | ML417 supplier | purchase | cost | manufacturer | order | distributor | buy 1386162-69-1 | 1386162-69-1 supplier