Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4993 | Purity: >98% |
 | |
| Chemical structure of ML311 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 315698-17-0 |
|---|---|
| Purity | >98% |
| Formula | C23H24F3N3O |
| Mol Weight | 415.4514 |
| CoA | CoA of ML311 |
| Smiles: | CCN1CCN(CC1)C(C2=CC=C(C=C2)C(F)(F)F)C3=C(C4=C(C=CC=N4)C=C3)O |
|---|
KEYWORDS: buy ML311 | ML311 supplier | purchase | cost | manufacturer | order | distributor | buy 315698-17-0 | 315698-17-0 supplier