Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4992 | Purity: >98% |
 | |
| Chemical structure of ML303 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1638211-04-7 |
|---|---|
| Purity | >98% |
| Formula | C21H16F3N3O2 |
| Mol Weight | 399.3658 |
| CoA | CoA of ML303 |
| Smiles: | CC1=NN(C2=NC=CC(=C12)C3=CC(=C(C=C3)O)OC)C4=CC=C(C=C4)C(F)(F)F |
|---|
KEYWORDS: buy ML303 | ML303 supplier | purchase | cost | manufacturer | order | distributor | buy 1638211-04-7 | 1638211-04-7 supplier