Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2341 | Purity: >98% |
 | |
| Chemical structure of ML264 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1550008-55-3 |
|---|---|
| Purity | >98% |
| Formula | C17H21ClN2O4S |
| Mol Weight | 384.878 |
| CoA | CoA of ML264 |
| Smiles: | CN(C1CCS(=O)(=O)CC1)C(=O)CNC(=O)\C=C\C1=CC=CC(Cl)=C1 |
|---|
KEYWORDS: buy ML264 | ML264 supplier | purchase | cost | manufacturer | order | distributor | buy 1550008-55-3 | 1550008-55-3 supplier