Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4982 | Purity: >98% |
 | |
| Chemical structure of ML226 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2055172-43-3 |
|---|---|
| Purity | >98% |
| Formula | C23H26N4O2 |
| Mol Weight | 390.4781 |
| CoA | CoA of ML226 |
| Smiles: | CCC1CCCCN1C(=O)N2N=CC(=N2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O |
|---|
KEYWORDS: buy ML226 | ML226 supplier | purchase | cost | manufacturer | order | distributor | buy 2055172-43-3 | 2055172-43-3 supplier