Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2308 | Purity: >98% |
 | |
| Chemical structure of ML224 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | NCGC00242364 |
|---|---|
| Synonyms 2 | ANTAG3 |
| CAS No. | 1338824-21-7 |
| Purity | >98% |
| Formula | C31H31N3O5 |
| Mol Weight | 525.5949 |
| CoA | CoA of ML224 |
| Smiles: | COC1=CC=C(C=C1COC1=C(C)C=C(NC(C)=O)C=C1C)C1NC2=C(C=CC=C2)C(=O)N1CC1=CC=CO1 |
|---|
KEYWORDS: buy ML224 | ML224 supplier | purchase | cost | manufacturer | order | distributor | buy 1338824-21-7 | 1338824-21-7 supplier