Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2551 | Purity: >98% |
 | |
| Chemical structure of ML213 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 489402-47-3 |
|---|---|
| Purity | >98% |
| Formula | C17H23NO |
| Mol Weight | 257.3706 |
| CoA | CoA of ML213 |
| Smiles: | CC1=CC(C)=C(NC(=O)C2CC3CCC2C3)C(C)=C1 |
|---|
KEYWORDS: buy ML213 | ML213 supplier | purchase | cost | manufacturer | order | distributor | buy 489402-47-3 | 489402-47-3 supplier