Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A567 | Purity: >98% |
 | |
| Chemical structure of (-)-MK801 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 121917-57-5 |
|---|---|
| Purity | >98% |
| Formula | C20H19NO4 |
| Mol Weight | 337.3692 |
| CoA | CoA of (-)-MK801 |
| Smiles: | OC(=O)\C=C/C(O)=O.C[C@@]12N[C@@H](CC3=CC=CC=C13)C1=CC=CC=C21 |
|---|
KEYWORDS: buy (-)-MK801 | (-)-MK801 supplier | purchase | cost | manufacturer | order | distributor | buy 121917-57-5 | 121917-57-5 supplier