Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2796 | Purity: >98% |
 | |
| Chemical structure of MK5046 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1022152-69-7 |
|---|---|
| Purity | >98% |
| Formula | C20H18F6N4O |
| Mol Weight | 444.3735 |
| CoA | CoA of MK5046 |
| Smiles: | O[C@@](CC1=NC=C(CC2(CC2)C(F)(F)F)N1)(C1=CC=C(C=C1)N1C=CC=N1)C(F)(F)F |
|---|
KEYWORDS: buy MK5046 | MK5046 supplier | purchase | cost | manufacturer | order | distributor | buy 1022152-69-7 | 1022152-69-7 supplier