Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1851 | Purity: >98% |
 | |
| Chemical structure of MK0941 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1137916-97-2 |
|---|---|
| Purity | >98% |
| Formula | C22H28N4O9S2 |
| Mol Weight | 556.609 |
| CoA | CoA of MK0941 |
| Smiles: | CS(O)(=O)=O.CCS(=O)(=O)C1=NC=C(OC2=CC(O[C@@H](C)CO)=CC(=C2)C(=O)NC2=NN(C)C=C2)C=C1 |
|---|
KEYWORDS: buy MK0941 | MK0941 supplier | purchase | cost | manufacturer | order | distributor | buy 1137916-97-2 | 1137916-97-2 supplier