Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1113 | Purity: >98% |
 | |
| Chemical structure of MK-8745 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 885325-71-3 |
|---|---|
| Purity | >98% |
| Formula | C20H19ClFN5OS |
| Mol Weight | 431.914 |
| CoA | CoA of MK-8745 |
| Smiles: | FC1=C(Cl)C=CC=C1C(=O)N1CCN(CC2=NC(NC3=NC=CS3)=CC=C2)CC1 |
|---|
KEYWORDS: buy MK-8745 | MK-8745 supplier | purchase | cost | manufacturer | order | distributor | buy 885325-71-3 | 885325-71-3 supplier