Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2612 | Purity: >98% |
 | |
| Chemical structure of MK-8033 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1001917-37-8 |
|---|---|
| Purity | >98% |
| Formula | C25H21N5O3S |
| Mol Weight | 471.531 |
| CoA | CoA of MK-8033 |
| Smiles: | CN1C=C(C=N1)C1=CN=C2C=CC3=CC=C(CS(=O)(=O)NCC4=CC=CC=N4)C=C3C(=O)C2=C1 |
|---|
KEYWORDS: buy MK-8033 | MK-8033 supplier | purchase | cost | manufacturer | order | distributor | buy 1001917-37-8 | 1001917-37-8 supplier