Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2878 | Purity: >98% |
 | |
| Chemical structure of MK-4827 R-enantiomer |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1038915-58-0 |
|---|---|
| Purity | >98% |
| Formula | C19H20N4O |
| Mol Weight | 320.3883 |
| CoA | CoA of MK-4827 R-enantiomer |
| Smiles: | NC(=O)C1=CC=CC2=CN(N=C12)C1=CC=C(C=C1)[C@H]1CCCNC1 |
|---|
KEYWORDS: buy MK-4827 R-enantiomer | MK-4827 R-enantiomer supplier | purchase | cost | manufacturer | order | distributor | buy 1038915-58-0 | 1038915-58-0 supplier