Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1301 | Purity: >98% |
 | |
| Chemical structure of MK-4101 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 935273-79-3 |
|---|---|
| Purity | >98% |
| Formula | C24H24F5N5O |
| Mol Weight | 493.4723 |
| CoA | CoA of MK-4101 |
| Smiles: | CN1C(=NN=C1C12CCC(CC1)(CC2)C1=NOC(=N1)C1CC(F)(F)C1)C1=CC=CC=C1C(F)(F)F |
|---|
KEYWORDS: buy MK-4101 | MK-4101 supplier | purchase | cost | manufacturer | order | distributor | buy 935273-79-3 | 935273-79-3 supplier