Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1566 | Purity: >98% |
 | |
| Chemical structure of MK-2461 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 917879-39-1 |
|---|---|
| Purity | >98% |
| Formula | C24H25N5O5S |
| Mol Weight | 495.551 |
| CoA | CoA of MK-2461 |
| Smiles: | CN(C[C@@H]1COCCO1)S(=O)(=O)NC1=CC2=C(C=C1)C=CC1=C(C=C(C=N1)C1=CN(C)N=C1)C2=O |
|---|
KEYWORDS: buy MK-2461 | MK-2461 supplier | purchase | cost | manufacturer | order | distributor | buy 917879-39-1 | 917879-39-1 supplier