Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1270 | Purity: >98% |
 | |
| Chemical structure of MK 0557 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 328232-95-7 |
|---|---|
| Purity | >98% |
| Formula | C22H19FN4O3 |
| Mol Weight | 406.4097 |
| CoA | CoA of MK 0557 |
| Smiles: | FC1=C(C=CC=C1)N1C=CC(NC(=O)[C@H]2CC[C@]3(CC2)OC(=O)C2=CC=NC=C32)=N1 |
|---|
KEYWORDS: buy MK 0557 | MK 0557 supplier | purchase | cost | manufacturer | order | distributor | buy 328232-95-7 | 328232-95-7 supplier