Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13980 | Purity: >98% |
 | |
| Chemical structure of Mixxim BB 200 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 30653-05-5 |
|---|---|
| Purity | >98% |
| Formula | C27H22N6O2 |
| Mol Weight | 462.5026 |
| CoA | CoA of Mixxim BB 200 |
| Smiles: | OC=1C(=CC(=CC1CC=2C=C(C=C(C2O)N3N=C4C=CC=CC4=N3)C)C)N5N=C6C=CC=CC6=N5 |
|---|
KEYWORDS: buy Mixxim BB 200 | Mixxim BB 200 supplier | purchase | cost | manufacturer | order | distributor | buy 30653-05-5 | 30653-05-5 supplier