Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14646 | Purity: >98% |
 | |
| Chemical structure of MitoNeoD |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2375088-89-2 |
|---|---|
| Purity | >98% |
| Formula | C54H66N3O3PS |
| Mol Weight | 869.165 |
| CoA | CoA of MitoNeoD |
| Smiles: | [2H]C1(C2=C(C=CC(=C2)NCC(C)(C)C)C3=C(N1CCCCCC[P+](C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)C=C(C=C3)NCC(C)(C)C)C7=CC=CC=C7.CS(=O)(=O)[O-] |
|---|
KEYWORDS: buy MitoNeoD | MitoNeoD supplier | purchase | cost | manufacturer | order | distributor | buy 2375088-89-2 | 2375088-89-2 supplier