Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2499 | Purity: >98% |
 | |
| Chemical structure of Mirin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1198097-97-0 |
|---|---|
| Purity | >98% |
| Formula | C10H8N2O2S |
| Mol Weight | 220.248 |
| CoA | CoA of Mirin |
| Smiles: | NC1=NC(=O)\C(S1)=C\C1=CC=C(O)C=C1 |
|---|
KEYWORDS: buy Mirin | Mirin supplier | purchase | cost | manufacturer | order | distributor | buy 1198097-97-0 | 1198097-97-0 supplier