Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2098 | Purity: >98% |
 | |
| Chemical structure of MI-3 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1271738-59-0 |
|---|---|
| Purity | >98% |
| Formula | C18H25N5S2 |
| Mol Weight | 375.555 |
| CoA | CoA of MI-3 |
| Smiles: | CC(C)C1=CC2=C(N=CN=C2S1)N1CCN(CC1)C1=NCC(C)(C)S1 |
|---|
KEYWORDS: buy MI-3 | MI-3 supplier | purchase | cost | manufacturer | order | distributor | buy 1271738-59-0 | 1271738-59-0 supplier