Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A8524 | Purity: >98% |
 | |
| Chemical structure of MH-26774 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2740660-67-5 |
|---|---|
| Purity | >98% |
| Formula | C17H11BrClFN2O3S2 |
| Mol Weight | 489.766 |
| CoA | CoA of MH-26774 |
| Smiles: | O=C(NC1=CC=C(F)C=C1)C2=CC=CC(NS(=O)(C3=CC(Br)=C(Cl)S3)=O)=C2 |
|---|
KEYWORDS: buy MH-26774 | MH-26774 supplier | purchase | cost | manufacturer | order | distributor | buy 2740660-67-5 | 2740660-67-5 supplier