Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1887 | Purity: >98% |
 | |
| Chemical structure of MF63 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 892549-43-8 |
|---|---|
| Purity | >98% |
| Formula | C23H11ClN4 |
| Mol Weight | 378.813 |
| CoA | CoA of MF63 |
| Smiles: | ClC1=CC2=C(C=C1)C1=C(N=C(N1)C1=C(C=CC=C1C#N)C#N)C1=C2C=CC=C1 |
|---|
KEYWORDS: buy MF63 | MF63 supplier | purchase | cost | manufacturer | order | distributor | buy 892549-43-8 | 892549-43-8 supplier