Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14292 | Purity: >98% |
 | |
| Chemical structure of Metribolone |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 965-93-5 |
|---|---|
| Purity | >98% |
| Formula | C19H24O2 |
| Mol Weight | 284.3927 |
| CoA | CoA of Metribolone |
| Smiles: | C[C@@]1(CC[C@@H]2[C@@]1(C=CC3=C4CCC(=O)C=C4CC[C@@H]23)C)O |
|---|
KEYWORDS: buy Metribolone | Metribolone supplier | purchase | cost | manufacturer | order | distributor | buy 965-93-5 | 965-93-5 supplier