Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13562G | Purity: >95% |
 | |
| Chemical structure of Methyl 3-O-benzyl-α-L-rhamnopyranoside |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 75336-82-2 |
|---|---|
| Purity | >95% |
| Formula | C14H20O5 |
| Mol Weight | 268.3056 |
| CoA | CoA of Methyl 3-O-benzyl-α-L-rhamnopyranoside |
| Smiles: | O(CC1=CC=CC=C1)[C@H]2[C@@H](O)[C@H](OC)O[C@@H](C)[C@@H]2O |
|---|
KEYWORDS: buy Methyl 3-O-benzyl-α-L-rhamnopyranoside | Methyl 3-O-benzyl-α-L-rhamnopyranoside supplier | purchase | cost | manufacturer | order | distributor | buy 75336-82-2 | 75336-82-2 supplier