Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3480 | Purity: >98% |
 | |
| Chemical structure of Metarrestin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ML246 |
|---|---|
| CAS No. | 1443414-10-5 |
| Purity | >98% |
| Formula | C31H30N4O |
| Mol Weight | 474.5961 |
| CoA | CoA of Metarrestin |
| Smiles: | C1CC(CCC1N2C=NC3=C(C2=N)C(=C(N3CC4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6)O |
|---|
KEYWORDS: buy Metarrestin | Metarrestin supplier | purchase | cost | manufacturer | order | distributor | buy 1443414-10-5 | 1443414-10-5 supplier