Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12432 | Purity: >98% |
 | |
| Chemical structure of MDMB-PICA |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1971007-98-3 |
|---|---|
| Purity | >98% |
| Formula | C21H30N2O3 |
| Mol Weight | 358.4745 |
| CoA | CoA of MDMB-PICA |
| Smiles: | C(N[C@H](C(OC)=O)[C@@](C)(C)C)(=O)C=1C=2C(N(CCCCC)C1)=CC=CC2 |
|---|
KEYWORDS: buy MDMB-PICA | MDMB-PICA supplier | purchase | cost | manufacturer | order | distributor | buy 1971007-98-3 | 1971007-98-3 supplier