Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1094 | Purity: >98% |
 | |
| Chemical structure of MDL72527 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | N1,N4-Di(buta-2,3-dien-1-yl)butane-1,4-diamine dihydrochloride |
|---|---|
| CAS No. | 93565-01-6 |
| Purity | >98% |
| Formula | C12H22Cl2N2 |
| Mol Weight | 265.222 |
| CoA | CoA of MDL72527 |
| Smiles: | Cl[H].Cl[H].C=C=CCNCCCCNCC=C=C |
|---|
KEYWORDS: buy MDL72527 | MDL72527 supplier | purchase | cost | manufacturer | order | distributor | buy 93565-01-6 | 93565-01-6 supplier