Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A270 | Purity: >98% |
 | |
| Chemical structure of MDL-29951 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 130798-51-5 |
|---|---|
| Purity | >98% |
| Formula | C12H9Cl2NO4 |
| Mol Weight | 302.11 |
| CoA | CoA of MDL-29951 |
| Smiles: | OC(=O)CCC1=C(NC2=C1C(Cl)=CC(Cl)=C2)C(O)=O |
|---|
KEYWORDS: buy MDL-29951 | MDL-29951 supplier | purchase | cost | manufacturer | order | distributor | buy 130798-51-5 | 130798-51-5 supplier