Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3443 | Purity: >98% |
 | |
| Chemical structure of MD2-TLR4-IN-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2249801-12-3 |
|---|---|
| Purity | >98% |
| Formula | C22H14Cl2N4O |
| Mol Weight | 421.279 |
| CoA | CoA of MD2-TLR4-IN-1 |
| Smiles: | ClC1=C(C(NC2=CC(C(C3=CC=C(NC=C4)C4=C3)=NN5)=C5C=C2)=O)C(Cl)=CC=C1 |
|---|
KEYWORDS: buy MD2-TLR4-IN-1 | MD2-TLR4-IN-1 supplier | purchase | cost | manufacturer | order | distributor | buy 2249801-12-3 | 2249801-12-3 supplier