Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13041 | Purity: >98% |
 | |
| Chemical structure of Mca-Arg |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1179354-71-2 |
|---|---|
| Purity | >98% |
| Formula | C18H22N4O6 |
| Mol Weight | 390.3905 |
| CoA | CoA of Mca-Arg |
| Smiles: | C(C(N[C@@H](CCCNC(=N)N)C(O)=O)=O)C=1C=2C(=CC(OC)=CC2)OC(=O)C1 |
|---|
KEYWORDS: buy Mca-Arg | Mca-Arg supplier | purchase | cost | manufacturer | order | distributor | buy 1179354-71-2 | 1179354-71-2 supplier