Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2097 | Purity: >98% |
 | |
| Chemical structure of MC1568 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 852475-26-4 |
|---|---|
| Purity | >98% |
| Formula | C17H15FN2O3 |
| Mol Weight | 314.311 |
| CoA | CoA of MC1568 |
| Smiles: | CN1C(\C=C\C(=O)NO)=CC=C1\C=C\C(=O)C1=CC=CC(F)=C1 |
|---|
KEYWORDS: buy MC1568 | MC1568 supplier | purchase | cost | manufacturer | order | distributor | buy 852475-26-4 | 852475-26-4 supplier