Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2656 | Purity: >98% |
 | |
| Chemical structure of Maytansinol |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Ansamitocin P-0 |
|---|---|
| CAS No. | 57103-68-1 |
| Purity | >98% |
| Formula | C28H37ClN2O8 |
| Mol Weight | 565.055 |
| CoA | CoA of Maytansinol |
| Smiles: | [H][C@@]12C[C@@](O)(NC(=O)O1)[C@]([H])(OC)\C=C\C=C(C)\CC1=CC(N(C)C(=O)C[C@H](O)[C@]3(C)O[C@H]3[C@@H]2C)=C(Cl)C(OC)=C1 |
|---|
KEYWORDS: buy Maytansinol | Maytansinol supplier | purchase | cost | manufacturer | order | distributor | buy 57103-68-1 | 57103-68-1 supplier