Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16012 | Purity: >98% |
 | |
| Chemical structure of MARY1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3097167-87-5 |
|---|---|
| Purity | >98% |
| Formula | C18H17F3N4O2 |
| Mol Weight | 378.3484 |
| State | Solid |
| CoA | CoA of MARY1 |
| Smiles: | O=C(NC=1N=C(C=CC1)C(=O)N2CCN(C)CC2)C=3C(F)=CC(F)=CC3F |
|---|
KEYWORDS: buy MARY1 | MARY1 supplier | purchase | cost | manufacturer | order | distributor | buy 3097167-87-5 | 3097167-87-5 supplier