Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13084 | Purity: >98% |
 | |
| Chemical structure of Manganese tripeptide-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 611182-15-1 |
|---|---|
| Purity | >98% |
| Formula | C14H22MnN6O4 |
| Mol Weight | 393.3003 |
| CoA | CoA of Manganese tripeptide-1 |
| Smiles: | C(N[C@@H](CCCCN)C([O-])=O)(=O)[C@H]1[N-]2[Mn+2]([N]=3C(C1)=CNC3)[NH2]CC2=O |
|---|
KEYWORDS: buy Manganese tripeptide-1 | Manganese tripeptide-1 supplier | purchase | cost | manufacturer | order | distributor | buy 611182-15-1 | 611182-15-1 supplier