Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12585 | Purity: >98% |
 | |
| Chemical structure of Macropa-NCS |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2146095-31-8 |
|---|---|
| Purity | >98% |
| Formula | C27H35N5O8S |
| Mol Weight | 589.661 |
| CoA | CoA of Macropa-NCS |
| Smiles: | O=C(O)C=1N=C(C=CC1)CN2CCOCCOCCN(CC3=NC(=CC(N=C=S)=C3)C(=O)O)CCOCCOCC2 |
|---|
KEYWORDS: buy Macropa-NCS | Macropa-NCS supplier | purchase | cost | manufacturer | order | distributor | buy 2146095-31-8 | 2146095-31-8 supplier