Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2707 | Purity: >98% |
 | |
| Chemical structure of M-3814 R-isomer |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | (R)-Nedisertib |
|---|---|
| CAS No. | 1637542-32-5 |
| Purity | >98% |
| Formula | C24H21ClFN5O3 |
| Mol Weight | 481.907 |
| CoA | CoA of M-3814 R-isomer |
| Smiles: | COC1=NN=C(C=C1)[C@H](O)C1=CC(=C(F)C=C1Cl)C1=C2C=CC(=CC2=NC=N1)N1CCOCC1 |
|---|
KEYWORDS: buy M-3814 R-isomer | M-3814 R-isomer supplier | purchase | cost | manufacturer | order | distributor | buy 1637542-32-5 | 1637542-32-5 supplier