Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2611 | Purity: >98% |
 | |
| Chemical structure of LY404187 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 211311-95-4 |
|---|---|
| Purity | >98% |
| Formula | C19H22N2O2S |
| Mol Weight | 342.455 |
| CoA | CoA of LY404187 |
| Smiles: | CC(C)S(=O)(=O)NCC(C)C1=CC=C(C=C1)C1=CC=C(C=C1)C#N |
|---|
KEYWORDS: buy LY404187 | LY404187 supplier | purchase | cost | manufacturer | order | distributor | buy 211311-95-4 | 211311-95-4 supplier