Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1638 | Purity: >98% |
 | |
| Chemical structure of LY3009120 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1454682-72-4 |
|---|---|
| Purity | >98% |
| Formula | C23H29FN6O |
| Mol Weight | 424.5144 |
| CoA | CoA of LY3009120 |
| Smiles: | CNC1=NC2=C(C=N1)C=C(C(C)=N2)C1=CC(NC(=O)NCCC(C)(C)C)=C(F)C=C1C |
|---|
KEYWORDS: buy LY3009120 | LY3009120 supplier | purchase | cost | manufacturer | order | distributor | buy 1454682-72-4 | 1454682-72-4 supplier