Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A156 | Purity: >98% |
 | |
| Chemical structure of LY2940680 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Taladegib |
|---|---|
| CAS No. | 1258861-20-9 |
| Purity | >98% |
| Formula | C26H24F4N6O |
| Mol Weight | 512.502 |
| CoA | CoA of LY2940680 |
| Smiles: | CN(C1CCN(CC1)C1=NN=C(C2=CC=NN2C)C2=C1C=CC=C2)C(=O)C1=CC=C(F)C=C1C(F)(F)F |
|---|
KEYWORDS: buy LY2940680 | LY2940680 supplier | purchase | cost | manufacturer | order | distributor | buy 1258861-20-9 | 1258861-20-9 supplier