Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1340 | Purity: >98% |
 | |
| Chemical structure of LY2874455 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1254473-64-7 |
|---|---|
| Purity | >98% |
| Formula | C21H19Cl2N5O2 |
| Mol Weight | 444.314 |
| CoA | CoA of LY2874455 |
| Smiles: | C[C@@H](OC1=CC2=C(NN=C2\C=C\C2=CN(CCO)N=C2)C=C1)C1=C(Cl)C=NC=C1Cl |
|---|
KEYWORDS: buy LY2874455 | LY2874455 supplier | purchase | cost | manufacturer | order | distributor | buy 1254473-64-7 | 1254473-64-7 supplier