Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1680 | Purity: >98% |
 | |
| Chemical structure of LY-3200882 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1898283-02-7 |
|---|---|
| Purity | >98% |
| Formula | C24H29N5O3 |
| Mol Weight | 435.5188 |
| CoA | CoA of LY-3200882 |
| Smiles: | CC(C)(O)C1=NC=CC(NC2=NC=CC(OC3=CN(N=C3C3CCOCC3)C3CC3)=C2)=C1 |
|---|
KEYWORDS: buy LY-3200882 | LY-3200882 supplier | purchase | cost | manufacturer | order | distributor | buy 1898283-02-7 | 1898283-02-7 supplier