Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1746 | Purity: >98% |
 | |
| Chemical structure of LY 303511 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 154447-38-8 |
|---|---|
| Purity | >98% |
| Formula | C19H18N2O2 |
| Mol Weight | 306.3584 |
| CoA | CoA of LY 303511 |
| Smiles: | O=C1C=C(OC2=C1C=CC=C2C1=CC=CC=C1)N1CCNCC1 |
|---|
KEYWORDS: buy LY 303511 | LY 303511 supplier | purchase | cost | manufacturer | order | distributor | buy 154447-38-8 | 154447-38-8 supplier