Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2288 | Purity: >98% |
 | |
| Chemical structure of LX7101 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1192189-69-7 |
|---|---|
| Purity | >98% |
| Formula | C23H29N7O3 |
| Mol Weight | 451.5215 |
| CoA | CoA of LX7101 hydrochloride |
| Smiles: | CN(C)C(=O)OC1=CC=CC(NC(=O)C2(CN)CCN(CC2)C2=C3C(C)=CNC3=NC=N2)=C1 |
|---|
KEYWORDS: buy LX7101 hydrochloride | LX7101 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1192189-69-7 | 1192189-69-7 supplier