Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A322 | Purity: >98% |
 | |
| Chemical structure of LX1606 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Telotristat ethyl |
|---|---|
| CAS No. | 1033805-22-9 |
| Purity | >98% |
| Formula | C27H26ClF3N6O3 |
| Mol Weight | 574.982 |
| CoA | CoA of LX1606 |
| Smiles: | CCOC(=O)[C@@H](N)CC1=CC=C(C=C1)C1=NC(N)=NC(O[C@H](C2=CC=C(Cl)C=C2N2C=CC(C)=N2)C(F)(F)F)=C1 |
|---|
KEYWORDS: buy LX1606 | LX1606 supplier | purchase | cost | manufacturer | order | distributor | buy 1033805-22-9 | 1033805-22-9 supplier