Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1771 | Purity: >98% |
 | |
| Chemical structure of Lubiprostone |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 333963-40-9 |
|---|---|
| Purity | >98% |
| Formula | C20H32F2O5 |
| Mol Weight | 390.4619 |
| CoA | CoA of Lubiprostone |
| Smiles: | CCCCC(F)(F)[C@@]1(O)CC[C@H]2[C@@H](CC(=O)[C@@H]2CCCCCCC(O)=O)O1 |
|---|
KEYWORDS: buy Lubiprostone | Lubiprostone supplier | purchase | cost | manufacturer | order | distributor | buy 333963-40-9 | 333963-40-9 supplier