Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3766 | Purity: >98% |
 | |
| Chemical structure of Lu AE 58054 Hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Idalopirdine Hydrochloride |
|---|---|
| CAS No. | 467458-02-2 |
| Purity | >98% |
| Formula | C20H20ClF5N2O |
| Mol Weight | 434.831 |
| CoA | CoA of Lu AE 58054 Hydrochloride |
| Smiles: | FC1=CC(NC=C2CCNCC3=CC(OCC(F)(F)C(F)F)=CC=C3)=C2C=C1.Cl |
|---|
KEYWORDS: buy Lu AE 58054 Hydrochloride | Lu AE 58054 Hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 467458-02-2 | 467458-02-2 supplier